C29H39N3O7 — CID 155375409
[3-(2,4-dimethylpentanoylamino)-5-[(2-ethyl-4-methylpentanoyl)amino]phenyl]methyl (4-nitrophenyl) carbonate (PubChem CID 155375409) has the molecular formula C29H39N3O7 and a molecular weight of 541.65 g/mol. Its IUPAC name is [3-(2,4-dimethylpentanoylamino)-5-[(2-ethyl-4-methylpentanoyl)amino]phenyl]methyl (4-nitrophenyl) carbonate.
| Compound Name | [3-(2,4-dimethylpentanoylamino)-5-[(2-ethyl-4-methylpentanoyl)amino]phenyl]methyl (4-nitrophenyl) carbonate |
|---|---|
| PubChem CID | 155375409 |
| Molecular Formula | C29H39N3O7 |
| Molecular Weight | 541.65 g/mol |
| Exact Mass | 541.28 |
| IUPAC Name | [3-(2,4-dimethylpentanoylamino)-5-[(2-ethyl-4-methylpentanoyl)amino]phenyl]methyl (4-nitrophenyl) carbonate |
| SMILES | CCC(CC(C)C)C(=O)Nc1cc(COC(=O)Oc2ccc([N+](=O)[O-])cc2)cc(NC(=O)C(C)CC(C)C)c1 |
| InChI | InChI=1S/C29H39N3O7/c1-7-22(13-19(4)5)28(34)31-24-15-21(14-23(16-24)30-27(33)20(6)12-18(2)3)17-38-29(35)39-26-10-8-25(9-11-26)32(36)37/h8-11,14-16,18-20,22H,7,12-13,17H2,1-6H3,(H,30,33)(H,31,34) |
| InChIKey | OPOFWNYHQTXTCL-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 136.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.65 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|