C12H11F3N2O6 — CID 20535059
(4-nitrophenyl) 3-[(2,2,2-trifluoroacetyl)amino]propyl carbonate (PubChem CID 20535059) has the molecular formula C12H11F3N2O6 and a molecular weight of 336.22 g/mol. Its IUPAC name is (4-nitrophenyl) 3-[(2,2,2-trifluoroacetyl)amino]propyl carbonate.
| Compound Name | (4-nitrophenyl) 3-[(2,2,2-trifluoroacetyl)amino]propyl carbonate |
|---|---|
| PubChem CID | 20535059 |
| Molecular Formula | C12H11F3N2O6 |
| Molecular Weight | 336.22 g/mol |
| Exact Mass | 336.06 |
| IUPAC Name | (4-nitrophenyl) 3-[(2,2,2-trifluoroacetyl)amino]propyl carbonate |
| SMILES | O=C(OCCCNC(=O)C(F)(F)F)Oc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C12H11F3N2O6/c13-12(14,15)10(18)16-6-1-7-22-11(19)23-9-4-2-8(3-5-9)17(20)21/h2-5H,1,6-7H2,(H,16,18) |
| InChIKey | WQHIHIKQLFEYNS-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.22 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|