About 9-hydroperoxyperoxynonyl (4-nitrophenyl) carbonate
9-hydroperoxyperoxynonyl (4-nitrophenyl) carbonate (PubChem CID 87060473) has the molecular formula C16H23NO9
and a molecular weight of 373.36 g/mol. Its IUPAC name is 9-hydroperoxyperoxynonyl (4-nitrophenyl) carbonate.
Molecular Properties
| Compound Name | 9-hydroperoxyperoxynonyl (4-nitrophenyl) carbonate |
| PubChem CID | 87060473 |
| Molecular Formula | C16H23NO9 |
| Molecular Weight | 373.36 g/mol |
| Exact Mass | 373.14 |
| IUPAC Name | 9-hydroperoxyperoxynonyl (4-nitrophenyl) carbonate |
| SMILES | O=C(OCCCCCCCCCOOOO)Oc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C16H23NO9/c18-16(24-15-10-8-14(9-11-15)17(19)20)22-12-6-4-2-1-3-5-7-13-23-26-25-21/h8-11,21H,1-7,12-13H2 |
| InChIKey | KWCGLSRAFMQOOV-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 126.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.36 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|
Analyze 9-hydroperoxyperoxynonyl (4-nitrophenyl) carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-hydroperoxyperoxynonyl (4-nitrophenyl) carbonate?
The IUPAC name of 9-hydroperoxyperoxynonyl (4-nitrophenyl) carbonate (CID 87060473) is 9-hydroperoxyperoxynonyl (4-nitrophenyl) carbonate.
What is the SMILES notation for 9-hydroperoxyperoxynonyl (4-nitrophenyl) carbonate?
The canonical SMILES for 9-hydroperoxyperoxynonyl (4-nitrophenyl) carbonate is O=C(OCCCCCCCCCOOOO)Oc1ccc([N+](=O)[O-])cc1.
What is the InChIKey of 9-hydroperoxyperoxynonyl (4-nitrophenyl) carbonate?
The InChIKey is KWCGLSRAFMQOOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23NO9/c18-16(24-15-10-8-14(9-11-15)17(19)20)22-12-6-4-2-1-3-5-7-13-23-26-25-21/h8-11,21H,1-7,12-13H2.
What are the key properties of 9-hydroperoxyperoxynonyl (4-nitrophenyl) carbonate?
9-hydroperoxyperoxynonyl (4-nitrophenyl) carbonate has a molecular weight of 373.36 g/mol, XLogP of 4.19, 14 rotatable bonds, 1 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 9-hydroperoxyperoxynonyl (4-nitrophenyl) carbonate is sourced from PubChem (CID 87060473), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).