C17H14Br2O4 — CID 141005541
(E)-2-[2-[(2,4-dibromophenoxy)methyl]phenyl]-3-methoxyprop-2-enoic acid (PubChem CID 141005541) has the molecular formula C17H14Br2O4 and a molecular weight of 442.10 g/mol. Its IUPAC name is (E)-2-[2-[(2,4-dibromophenoxy)methyl]phenyl]-3-methoxyprop-2-enoic acid.
| Compound Name | (E)-2-[2-[(2,4-dibromophenoxy)methyl]phenyl]-3-methoxyprop-2-enoic acid |
|---|---|
| PubChem CID | 141005541 |
| Molecular Formula | C17H14Br2O4 |
| Molecular Weight | 442.10 g/mol |
| Exact Mass | 439.93 |
| IUPAC Name | (E)-2-[2-[(2,4-dibromophenoxy)methyl]phenyl]-3-methoxyprop-2-enoic acid |
| SMILES | CO/C=C(/C(=O)O)c1ccccc1COc1ccc(Br)cc1Br |
| InChI | InChI=1S/C17H14Br2O4/c1-22-10-14(17(20)21)13-5-3-2-4-11(13)9-23-16-7-6-12(18)8-15(16)19/h2-8,10H,9H2,1H3,(H,20,21)/b14-10+ |
| InChIKey | HELFRQPKXZDPTF-GXDHUFHOSA-N |
| XLogP | 4.86 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.10 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|