C20H20F2O5 — CID 141288383
(E)-2-[2-[(2,4-difluoro-3-propoxyphenoxy)methyl]phenyl]-3-methoxyprop-2-enoic acid (PubChem CID 141288383) has the molecular formula C20H20F2O5 and a molecular weight of 378.37 g/mol. Its IUPAC name is (E)-2-[2-[(2,4-difluoro-3-propoxyphenoxy)methyl]phenyl]-3-methoxyprop-2-enoic acid.
| Compound Name | (E)-2-[2-[(2,4-difluoro-3-propoxyphenoxy)methyl]phenyl]-3-methoxyprop-2-enoic acid |
|---|---|
| PubChem CID | 141288383 |
| Molecular Formula | C20H20F2O5 |
| Molecular Weight | 378.37 g/mol |
| Exact Mass | 378.13 |
| IUPAC Name | (E)-2-[2-[(2,4-difluoro-3-propoxyphenoxy)methyl]phenyl]-3-methoxyprop-2-enoic acid |
| SMILES | CCCOc1c(F)ccc(OCc2ccccc2/C(=C\OC)C(=O)O)c1F |
| InChI | InChI=1S/C20H20F2O5/c1-3-10-26-19-16(21)8-9-17(18(19)22)27-11-13-6-4-5-7-14(13)15(12-25-2)20(23)24/h4-9,12H,3,10-11H2,1-2H3,(H,23,24)/b15-12+ |
| InChIKey | QSFITVNRXLBHNU-NTCAYCPXSA-N |
| XLogP | 4.40 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.37 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|