C20H20Cl2O5 — CID 69304191
(E)-2-[2-[(3,5-dichloro-4-propan-2-yloxyphenoxy)methyl]phenyl]-3-methoxyprop-2-enoic acid (PubChem CID 69304191) has the molecular formula C20H20Cl2O5 and a molecular weight of 411.28 g/mol. Its IUPAC name is (E)-2-[2-[(3,5-dichloro-4-propan-2-yloxyphenoxy)methyl]phenyl]-3-methoxyprop-2-enoic acid.
| Compound Name | (E)-2-[2-[(3,5-dichloro-4-propan-2-yloxyphenoxy)methyl]phenyl]-3-methoxyprop-2-enoic acid |
|---|---|
| PubChem CID | 69304191 |
| Molecular Formula | C20H20Cl2O5 |
| Molecular Weight | 411.28 g/mol |
| Exact Mass | 410.07 |
| IUPAC Name | (E)-2-[2-[(3,5-dichloro-4-propan-2-yloxyphenoxy)methyl]phenyl]-3-methoxyprop-2-enoic acid |
| SMILES | CO/C=C(/C(=O)O)c1ccccc1COc1cc(Cl)c(OC(C)C)c(Cl)c1 |
| InChI | InChI=1S/C20H20Cl2O5/c1-12(2)27-19-17(21)8-14(9-18(19)22)26-10-13-6-4-5-7-15(13)16(11-25-3)20(23)24/h4-9,11-12H,10H2,1-3H3,(H,23,24)/b16-11+ |
| InChIKey | FYCMKWVKXULXIG-LFIBNONCSA-N |
| XLogP | 5.43 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.28 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|