C20H17Cl2NO5 — CID 87949265
(2E)-2-[2-[(4-but-3-yn-2-yloxy-3,5-dichlorophenoxy)methyl]phenyl]-2-methoxyiminoacetic acid (PubChem CID 87949265) has the molecular formula C20H17Cl2NO5 and a molecular weight of 422.26 g/mol. Its IUPAC name is (2E)-2-[2-[(4-but-3-yn-2-yloxy-3,5-dichlorophenoxy)methyl]phenyl]-2-methoxyiminoacetic acid.
| Compound Name | (2E)-2-[2-[(4-but-3-yn-2-yloxy-3,5-dichlorophenoxy)methyl]phenyl]-2-methoxyiminoacetic acid |
|---|---|
| PubChem CID | 87949265 |
| Molecular Formula | C20H17Cl2NO5 |
| Molecular Weight | 422.26 g/mol |
| Exact Mass | 421.05 |
| IUPAC Name | (2E)-2-[2-[(4-but-3-yn-2-yloxy-3,5-dichlorophenoxy)methyl]phenyl]-2-methoxyiminoacetic acid |
| SMILES | C#CC(C)Oc1c(Cl)cc(OCc2ccccc2/C(=N\OC)C(=O)O)cc1Cl |
| InChI | InChI=1S/C20H17Cl2NO5/c1-4-12(2)28-19-16(21)9-14(10-17(19)22)27-11-13-7-5-6-8-15(13)18(20(24)25)23-26-3/h1,5-10,12H,11H2,2-3H3,(H,24,25)/b23-18+ |
| InChIKey | NHKCFISSCNUQQH-PTGBLXJZSA-N |
| XLogP | 4.41 |
| TPSA | 77.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.26 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|