C22H25Cl2NO5 — CID 91521728
2-[2-[(3,5-dichloro-4-hexoxyphenoxy)methyl]phenyl]-2-methoxyiminoacetic acid (PubChem CID 91521728) has the molecular formula C22H25Cl2NO5 and a molecular weight of 454.35 g/mol. Its IUPAC name is 2-[2-[(3,5-dichloro-4-hexoxyphenoxy)methyl]phenyl]-2-methoxyiminoacetic acid.
| Compound Name | 2-[2-[(3,5-dichloro-4-hexoxyphenoxy)methyl]phenyl]-2-methoxyiminoacetic acid |
|---|---|
| PubChem CID | 91521728 |
| Molecular Formula | C22H25Cl2NO5 |
| Molecular Weight | 454.35 g/mol |
| Exact Mass | 453.11 |
| IUPAC Name | 2-[2-[(3,5-dichloro-4-hexoxyphenoxy)methyl]phenyl]-2-methoxyiminoacetic acid |
| SMILES | CCCCCCOc1c(Cl)cc(OCc2ccccc2C(=NOC)C(=O)O)cc1Cl |
| InChI | InChI=1S/C22H25Cl2NO5/c1-3-4-5-8-11-29-21-18(23)12-16(13-19(21)24)30-14-15-9-6-7-10-17(15)20(22(26)27)25-28-2/h6-7,9-10,12-13H,3-5,8,11,14H2,1-2H3,(H,26,27) |
| InChIKey | WBSGPLVKHKZASN-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 77.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.35 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|