C22H26Cl2N2O4 — CID 173157091
2-[2-[[3,5-dichloro-4-(2,2-dimethylpropoxy)phenoxy]methyl]phenyl]-2-methoxyimino-N-methylacetamide (PubChem CID 173157091) has the molecular formula C22H26Cl2N2O4 and a molecular weight of 453.37 g/mol. Its IUPAC name is 2-[2-[[3,5-dichloro-4-(2,2-dimethylpropoxy)phenoxy]methyl]phenyl]-2-methoxyimino-N-methylacetamide.
| Compound Name | 2-[2-[[3,5-dichloro-4-(2,2-dimethylpropoxy)phenoxy]methyl]phenyl]-2-methoxyimino-N-methylacetamide |
|---|---|
| PubChem CID | 173157091 |
| Molecular Formula | C22H26Cl2N2O4 |
| Molecular Weight | 453.37 g/mol |
| Exact Mass | 452.13 |
| IUPAC Name | 2-[2-[[3,5-dichloro-4-(2,2-dimethylpropoxy)phenoxy]methyl]phenyl]-2-methoxyimino-N-methylacetamide |
| SMILES | CNC(=O)C(=NOC)c1ccccc1COc1cc(Cl)c(OCC(C)(C)C)c(Cl)c1 |
| InChI | InChI=1S/C22H26Cl2N2O4/c1-22(2,3)13-30-20-17(23)10-15(11-18(20)24)29-12-14-8-6-7-9-16(14)19(26-28-5)21(27)25-4/h6-11H,12-13H2,1-5H3,(H,25,27) |
| InChIKey | OJFCBGGOCQHHMJ-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 69.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.37 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|