C20H19Cl2NO5 — CID 91040427
2-[2-[[3,5-dichloro-4-(cyclopropylmethoxy)phenoxy]methyl]phenyl]-2-methoxyiminoacetic acid (PubChem CID 91040427) has the molecular formula C20H19Cl2NO5 and a molecular weight of 424.28 g/mol. Its IUPAC name is 2-[2-[[3,5-dichloro-4-(cyclopropylmethoxy)phenoxy]methyl]phenyl]-2-methoxyiminoacetic acid.
| Compound Name | 2-[2-[[3,5-dichloro-4-(cyclopropylmethoxy)phenoxy]methyl]phenyl]-2-methoxyiminoacetic acid |
|---|---|
| PubChem CID | 91040427 |
| Molecular Formula | C20H19Cl2NO5 |
| Molecular Weight | 424.28 g/mol |
| Exact Mass | 423.06 |
| IUPAC Name | 2-[2-[[3,5-dichloro-4-(cyclopropylmethoxy)phenoxy]methyl]phenyl]-2-methoxyiminoacetic acid |
| SMILES | CON=C(C(=O)O)c1ccccc1COc1cc(Cl)c(OCC2CC2)c(Cl)c1 |
| InChI | InChI=1S/C20H19Cl2NO5/c1-26-23-18(20(24)25)15-5-3-2-4-13(15)11-27-14-8-16(21)19(17(22)9-14)28-10-12-6-7-12/h2-5,8-9,12H,6-7,10-11H2,1H3,(H,24,25) |
| InChIKey | XYDBANRBGRHRCL-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 77.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.28 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|