C23H21NO4S — CID 140990732
2-methoxyimino-2-[2-[[3-(2-thiophen-2-ylcyclopropyl)phenoxy]methyl]phenyl]acetic acid (PubChem CID 140990732) has the molecular formula C23H21NO4S and a molecular weight of 407.49 g/mol. Its IUPAC name is 2-methoxyimino-2-[2-[[3-(2-thiophen-2-ylcyclopropyl)phenoxy]methyl]phenyl]acetic acid.
| Compound Name | 2-methoxyimino-2-[2-[[3-(2-thiophen-2-ylcyclopropyl)phenoxy]methyl]phenyl]acetic acid |
|---|---|
| PubChem CID | 140990732 |
| Molecular Formula | C23H21NO4S |
| Molecular Weight | 407.49 g/mol |
| Exact Mass | 407.12 |
| IUPAC Name | 2-methoxyimino-2-[2-[[3-(2-thiophen-2-ylcyclopropyl)phenoxy]methyl]phenyl]acetic acid |
| SMILES | CON=C(C(=O)O)c1ccccc1COc1cccc(C2CC2c2cccs2)c1 |
| InChI | InChI=1S/C23H21NO4S/c1-27-24-22(23(25)26)18-9-3-2-6-16(18)14-28-17-8-4-7-15(12-17)19-13-20(19)21-10-5-11-29-21/h2-12,19-20H,13-14H2,1H3,(H,25,26) |
| InChIKey | PBLKYVFRONVHTH-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 68.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.49 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|