C21H19Cl2NO5 — CID 87774853
methyl (2E)-2-[2-[(4-but-3-yn-2-yloxy-3,5-dichlorophenoxy)methyl]phenyl]-2-methoxyiminoacetate (PubChem CID 87774853) has the molecular formula C21H19Cl2NO5 and a molecular weight of 436.29 g/mol. Its IUPAC name is methyl (2E)-2-[2-[(4-but-3-yn-2-yloxy-3,5-dichlorophenoxy)methyl]phenyl]-2-methoxyiminoacetate.
| Compound Name | methyl (2E)-2-[2-[(4-but-3-yn-2-yloxy-3,5-dichlorophenoxy)methyl]phenyl]-2-methoxyiminoacetate |
|---|---|
| PubChem CID | 87774853 |
| Molecular Formula | C21H19Cl2NO5 |
| Molecular Weight | 436.29 g/mol |
| Exact Mass | 435.06 |
| IUPAC Name | methyl (2E)-2-[2-[(4-but-3-yn-2-yloxy-3,5-dichlorophenoxy)methyl]phenyl]-2-methoxyiminoacetate |
| SMILES | C#CC(C)Oc1c(Cl)cc(OCc2ccccc2/C(=N\OC)C(=O)OC)cc1Cl |
| InChI | InChI=1S/C21H19Cl2NO5/c1-5-13(2)29-20-17(22)10-15(11-18(20)23)28-12-14-8-6-7-9-16(14)19(24-27-4)21(25)26-3/h1,6-11,13H,12H2,2-4H3/b24-19+ |
| InChIKey | WRGLLSPRWNSPCF-LYBHJNIJSA-N |
| XLogP | 4.50 |
| TPSA | 66.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.29 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|