C21H18Cl2O5 — CID 87774170
methyl (E)-2-[2-[(3,5-dichloro-4-prop-2-ynoxyphenoxy)methyl]phenyl]-3-methoxyprop-2-enoate (PubChem CID 87774170) has the molecular formula C21H18Cl2O5 and a molecular weight of 421.28 g/mol. Its IUPAC name is methyl (E)-2-[2-[(3,5-dichloro-4-prop-2-ynoxyphenoxy)methyl]phenyl]-3-methoxyprop-2-enoate.
| Compound Name | methyl (E)-2-[2-[(3,5-dichloro-4-prop-2-ynoxyphenoxy)methyl]phenyl]-3-methoxyprop-2-enoate |
|---|---|
| PubChem CID | 87774170 |
| Molecular Formula | C21H18Cl2O5 |
| Molecular Weight | 421.28 g/mol |
| Exact Mass | 420.05 |
| IUPAC Name | methyl (E)-2-[2-[(3,5-dichloro-4-prop-2-ynoxyphenoxy)methyl]phenyl]-3-methoxyprop-2-enoate |
| SMILES | C#CCOc1c(Cl)cc(OCc2ccccc2/C(=C\OC)C(=O)OC)cc1Cl |
| InChI | InChI=1S/C21H18Cl2O5/c1-4-9-27-20-18(22)10-15(11-19(20)23)28-12-14-7-5-6-8-16(14)17(13-25-2)21(24)26-3/h1,5-8,10-11,13H,9,12H2,2-3H3/b17-13+ |
| InChIKey | LAUVOMPJEIIAEE-GHRIWEEISA-N |
| XLogP | 4.74 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.28 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|