C25H24O5 — CID 14857839
methyl (E)-3-methoxy-2-[2-[[3-(phenoxymethyl)phenoxy]methyl]phenyl]prop-2-enoate (PubChem CID 14857839) has the molecular formula C25H24O5 and a molecular weight of 404.46 g/mol. Its IUPAC name is methyl (E)-3-methoxy-2-[2-[[3-(phenoxymethyl)phenoxy]methyl]phenyl]prop-2-enoate.
| Compound Name | methyl (E)-3-methoxy-2-[2-[[3-(phenoxymethyl)phenoxy]methyl]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 14857839 |
| Molecular Formula | C25H24O5 |
| Molecular Weight | 404.46 g/mol |
| Exact Mass | 404.16 |
| IUPAC Name | methyl (E)-3-methoxy-2-[2-[[3-(phenoxymethyl)phenoxy]methyl]phenyl]prop-2-enoate |
| SMILES | CO/C=C(/C(=O)OC)c1ccccc1COc1cccc(COc2ccccc2)c1 |
| InChI | InChI=1S/C25H24O5/c1-27-18-24(25(26)28-2)23-14-7-6-10-20(23)17-30-22-13-8-9-19(15-22)16-29-21-11-4-3-5-12-21/h3-15,18H,16-17H2,1-2H3/b24-18+ |
| InChIKey | CXTGGKZJGCIWBJ-HKOYGPOVSA-N |
| XLogP | 5.00 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.46 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|