C21H23NO5 — CID 88531224
methyl (Z)-2-[2-[[3-[(E)-ethoxyiminomethyl]phenoxy]methyl]phenyl]-3-methoxyprop-2-enoate (PubChem CID 88531224) has the molecular formula C21H23NO5 and a molecular weight of 369.42 g/mol. Its IUPAC name is methyl (Z)-2-[2-[[3-[(E)-ethoxyiminomethyl]phenoxy]methyl]phenyl]-3-methoxyprop-2-enoate.
| Compound Name | methyl (Z)-2-[2-[[3-[(E)-ethoxyiminomethyl]phenoxy]methyl]phenyl]-3-methoxyprop-2-enoate |
|---|---|
| PubChem CID | 88531224 |
| Molecular Formula | C21H23NO5 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.16 |
| IUPAC Name | methyl (Z)-2-[2-[[3-[(E)-ethoxyiminomethyl]phenoxy]methyl]phenyl]-3-methoxyprop-2-enoate |
| SMILES | CCO/N=C/c1cccc(OCc2ccccc2/C(=C/OC)C(=O)OC)c1 |
| InChI | InChI=1S/C21H23NO5/c1-4-27-22-13-16-8-7-10-18(12-16)26-14-17-9-5-6-11-19(17)20(15-24-2)21(23)25-3/h5-13,15H,4,14H2,1-3H3/b20-15-,22-13+ |
| InChIKey | NVTJJTOPIDJLIM-CHWPXTKPSA-N |
| XLogP | 3.80 |
| TPSA | 66.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|