C27H23BrO5 — CID 16747804
methyl (E)-2-[2-[[3-[(E)-3-(4-bromophenyl)prop-2-enoyl]phenoxy]methyl]phenyl]-3-methoxyprop-2-enoate (PubChem CID 16747804) has the molecular formula C27H23BrO5 and a molecular weight of 507.38 g/mol. Its IUPAC name is methyl (E)-2-[2-[[3-[(E)-3-(4-bromophenyl)prop-2-enoyl]phenoxy]methyl]phenyl]-3-methoxyprop-2-enoate.
| Compound Name | methyl (E)-2-[2-[[3-[(E)-3-(4-bromophenyl)prop-2-enoyl]phenoxy]methyl]phenyl]-3-methoxyprop-2-enoate |
|---|---|
| PubChem CID | 16747804 |
| Molecular Formula | C27H23BrO5 |
| Molecular Weight | 507.38 g/mol |
| Exact Mass | 506.07 |
| IUPAC Name | methyl (E)-2-[2-[[3-[(E)-3-(4-bromophenyl)prop-2-enoyl]phenoxy]methyl]phenyl]-3-methoxyprop-2-enoate |
| SMILES | CO/C=C(/C(=O)OC)c1ccccc1COc1cccc(C(=O)/C=C/c2ccc(Br)cc2)c1 |
| InChI | InChI=1S/C27H23BrO5/c1-31-18-25(27(30)32-2)24-9-4-3-6-21(24)17-33-23-8-5-7-20(16-23)26(29)15-12-19-10-13-22(28)14-11-19/h3-16,18H,17H2,1-2H3/b15-12+,25-18+ |
| InChIKey | ZTSKMWPASCRPEF-WLMJRQBISA-N |
| XLogP | 6.08 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.38 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|