C26H26O7 — CID 67954519
methyl 2-[2-[[3-hydroxy-5-(2-phenoxyethoxy)phenoxy]methyl]phenyl]-3-methoxyprop-2-enoate (PubChem CID 67954519) has the molecular formula C26H26O7 and a molecular weight of 450.49 g/mol. Its IUPAC name is methyl 2-[2-[[3-hydroxy-5-(2-phenoxyethoxy)phenoxy]methyl]phenyl]-3-methoxyprop-2-enoate.
| Compound Name | methyl 2-[2-[[3-hydroxy-5-(2-phenoxyethoxy)phenoxy]methyl]phenyl]-3-methoxyprop-2-enoate |
|---|---|
| PubChem CID | 67954519 |
| Molecular Formula | C26H26O7 |
| Molecular Weight | 450.49 g/mol |
| Exact Mass | 450.17 |
| IUPAC Name | methyl 2-[2-[[3-hydroxy-5-(2-phenoxyethoxy)phenoxy]methyl]phenyl]-3-methoxyprop-2-enoate |
| SMILES | COC=C(C(=O)OC)c1ccccc1COc1cc(O)cc(OCCOc2ccccc2)c1 |
| InChI | InChI=1S/C26H26O7/c1-29-18-25(26(28)30-2)24-11-7-6-8-19(24)17-33-23-15-20(27)14-22(16-23)32-13-12-31-21-9-4-3-5-10-21/h3-11,14-16,18,27H,12-13,17H2,1-2H3 |
| InChIKey | NHLCHWZJTIYDPI-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.49 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|