C28H34O5 — CID 91362443
ethane;methyl 3-methoxy-2-[2-[(3-phenoxyphenoxy)methyl]phenyl]prop-2-enoate (PubChem CID 91362443) has the molecular formula C28H34O5 and a molecular weight of 450.58 g/mol. Its IUPAC name is ethane;methyl 3-methoxy-2-[2-[(3-phenoxyphenoxy)methyl]phenyl]prop-2-enoate.
| Compound Name | ethane;methyl 3-methoxy-2-[2-[(3-phenoxyphenoxy)methyl]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 91362443 |
| Molecular Formula | C28H34O5 |
| Molecular Weight | 450.58 g/mol |
| Exact Mass | 450.24 |
| IUPAC Name | ethane;methyl 3-methoxy-2-[2-[(3-phenoxyphenoxy)methyl]phenyl]prop-2-enoate |
| SMILES | CC.CC.COC=C(C(=O)OC)c1ccccc1COc1cccc(Oc2ccccc2)c1 |
| InChI | InChI=1S/C24H22O5.2C2H6/c1-26-17-23(24(25)27-2)22-14-7-6-9-18(22)16-28-20-12-8-13-21(15-20)29-19-10-4-3-5-11-19;2*1-2/h3-15,17H,16H2,1-2H3;2*1-2H3 |
| InChIKey | IJGKFHTYUAYPQE-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.58 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|