C27H27NO6 — CID 88531221
methyl (Z)-3-methoxy-2-[2-[[3-[(E)-2-phenoxyethoxyiminomethyl]phenoxy]methyl]phenyl]prop-2-enoate (PubChem CID 88531221) has the molecular formula C27H27NO6 and a molecular weight of 461.51 g/mol. Its IUPAC name is methyl (Z)-3-methoxy-2-[2-[[3-[(E)-2-phenoxyethoxyiminomethyl]phenoxy]methyl]phenyl]prop-2-enoate.
| Compound Name | methyl (Z)-3-methoxy-2-[2-[[3-[(E)-2-phenoxyethoxyiminomethyl]phenoxy]methyl]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 88531221 |
| Molecular Formula | C27H27NO6 |
| Molecular Weight | 461.51 g/mol |
| Exact Mass | 461.18 |
| IUPAC Name | methyl (Z)-3-methoxy-2-[2-[[3-[(E)-2-phenoxyethoxyiminomethyl]phenoxy]methyl]phenyl]prop-2-enoate |
| SMILES | CO/C=C(\C(=O)OC)c1ccccc1COc1cccc(/C=N/OCCOc2ccccc2)c1 |
| InChI | InChI=1S/C27H27NO6/c1-30-20-26(27(29)31-2)25-14-7-6-10-22(25)19-33-24-13-8-9-21(17-24)18-28-34-16-15-32-23-11-4-3-5-12-23/h3-14,17-18,20H,15-16,19H2,1-2H3/b26-20-,28-18+ |
| InChIKey | ZORUBZBAQZJLEU-GBVUWOBFSA-N |
| XLogP | 4.86 |
| TPSA | 75.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.51 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|