C20H20Cl2O5 — CID 90835082
methyl 2-[2-[(3,5-dichloro-4-ethoxyphenoxy)methyl]phenyl]-3-methoxyprop-2-enoate (PubChem CID 90835082) has the molecular formula C20H20Cl2O5 and a molecular weight of 411.28 g/mol. Its IUPAC name is methyl 2-[2-[(3,5-dichloro-4-ethoxyphenoxy)methyl]phenyl]-3-methoxyprop-2-enoate.
| Compound Name | methyl 2-[2-[(3,5-dichloro-4-ethoxyphenoxy)methyl]phenyl]-3-methoxyprop-2-enoate |
|---|---|
| PubChem CID | 90835082 |
| Molecular Formula | C20H20Cl2O5 |
| Molecular Weight | 411.28 g/mol |
| Exact Mass | 410.07 |
| IUPAC Name | methyl 2-[2-[(3,5-dichloro-4-ethoxyphenoxy)methyl]phenyl]-3-methoxyprop-2-enoate |
| SMILES | CCOc1c(Cl)cc(OCc2ccccc2C(=COC)C(=O)OC)cc1Cl |
| InChI | InChI=1S/C20H20Cl2O5/c1-4-26-19-17(21)9-14(10-18(19)22)27-11-13-7-5-6-8-15(13)16(12-24-2)20(23)25-3/h5-10,12H,4,11H2,1-3H3 |
| InChIKey | FMHOOJDCROJYTI-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.28 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|