C19H15Cl2F3O5 — CID 69303373
2-[2-[[3,5-dichloro-4-(2,2,2-trifluoroethoxy)phenoxy]methyl]phenyl]-3-methoxyprop-2-enoic acid (PubChem CID 69303373) has the molecular formula C19H15Cl2F3O5 and a molecular weight of 451.22 g/mol. Its IUPAC name is 2-[2-[[3,5-dichloro-4-(2,2,2-trifluoroethoxy)phenoxy]methyl]phenyl]-3-methoxyprop-2-enoic acid.
| Compound Name | 2-[2-[[3,5-dichloro-4-(2,2,2-trifluoroethoxy)phenoxy]methyl]phenyl]-3-methoxyprop-2-enoic acid |
|---|---|
| PubChem CID | 69303373 |
| Molecular Formula | C19H15Cl2F3O5 |
| Molecular Weight | 451.22 g/mol |
| Exact Mass | 450.02 |
| IUPAC Name | 2-[2-[[3,5-dichloro-4-(2,2,2-trifluoroethoxy)phenoxy]methyl]phenyl]-3-methoxyprop-2-enoic acid |
| SMILES | COC=C(C(=O)O)c1ccccc1COc1cc(Cl)c(OCC(F)(F)F)c(Cl)c1 |
| InChI | InChI=1S/C19H15Cl2F3O5/c1-27-9-14(18(25)26)13-5-3-2-4-11(13)8-28-12-6-15(20)17(16(21)7-12)29-10-19(22,23)24/h2-7,9H,8,10H2,1H3,(H,25,26) |
| InChIKey | HYLNMTCALTUYRQ-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.22 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|