C21H16Cl2F6O5 — CID 87773723
methyl (E)-2-[2-[[3,5-dichloro-4-(1,1,2,3,3,3-hexafluoropropoxy)phenoxy]methyl]phenyl]-3-methoxyprop-2-enoate (PubChem CID 87773723) has the molecular formula C21H16Cl2F6O5 and a molecular weight of 533.25 g/mol. Its IUPAC name is methyl (E)-2-[2-[[3,5-dichloro-4-(1,1,2,3,3,3-hexafluoropropoxy)phenoxy]methyl]phenyl]-3-methoxyprop-2-enoate.
| Compound Name | methyl (E)-2-[2-[[3,5-dichloro-4-(1,1,2,3,3,3-hexafluoropropoxy)phenoxy]methyl]phenyl]-3-methoxyprop-2-enoate |
|---|---|
| PubChem CID | 87773723 |
| Molecular Formula | C21H16Cl2F6O5 |
| Molecular Weight | 533.25 g/mol |
| Exact Mass | 532.03 |
| IUPAC Name | methyl (E)-2-[2-[[3,5-dichloro-4-(1,1,2,3,3,3-hexafluoropropoxy)phenoxy]methyl]phenyl]-3-methoxyprop-2-enoate |
| SMILES | CO/C=C(/C(=O)OC)c1ccccc1COc1cc(Cl)c(OC(F)(F)C(F)C(F)(F)F)c(Cl)c1 |
| InChI | InChI=1S/C21H16Cl2F6O5/c1-31-10-14(18(30)32-2)13-6-4-3-5-11(13)9-33-12-7-15(22)17(16(23)8-12)34-21(28,29)19(24)20(25,26)27/h3-8,10,19H,9H2,1-2H3/b14-10+ |
| InChIKey | ZRTJCFCDUBYYKP-GXDHUFHOSA-N |
| XLogP | 6.60 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.25 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|