C23H24Cl2O5 — CID 69303388
(E)-2-[2-[(3,5-dichloro-4-cyclohexyloxyphenoxy)methyl]phenyl]-3-methoxyprop-2-enoic acid (PubChem CID 69303388) has the molecular formula C23H24Cl2O5 and a molecular weight of 451.35 g/mol. Its IUPAC name is (E)-2-[2-[(3,5-dichloro-4-cyclohexyloxyphenoxy)methyl]phenyl]-3-methoxyprop-2-enoic acid.
| Compound Name | (E)-2-[2-[(3,5-dichloro-4-cyclohexyloxyphenoxy)methyl]phenyl]-3-methoxyprop-2-enoic acid |
|---|---|
| PubChem CID | 69303388 |
| Molecular Formula | C23H24Cl2O5 |
| Molecular Weight | 451.35 g/mol |
| Exact Mass | 450.10 |
| IUPAC Name | (E)-2-[2-[(3,5-dichloro-4-cyclohexyloxyphenoxy)methyl]phenyl]-3-methoxyprop-2-enoic acid |
| SMILES | CO/C=C(/C(=O)O)c1ccccc1COc1cc(Cl)c(OC2CCCCC2)c(Cl)c1 |
| InChI | InChI=1S/C23H24Cl2O5/c1-28-14-19(23(26)27)18-10-6-5-7-15(18)13-29-17-11-20(24)22(21(25)12-17)30-16-8-3-2-4-9-16/h5-7,10-12,14,16H,2-4,8-9,13H2,1H3,(H,26,27)/b19-14+ |
| InChIKey | ZEPOAIWDVSQXMF-XMHGGMMESA-N |
| XLogP | 6.36 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.35 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|