C22H21BrN2O4 — CID 102174347
methyl (Z)-2-[2-[[3-(4-bromophenyl)-1-methylpyrazol-5-yl]oxymethyl]phenyl]-3-methoxyprop-2-enoate (PubChem CID 102174347) has the molecular formula C22H21BrN2O4 and a molecular weight of 457.32 g/mol. Its IUPAC name is methyl (Z)-2-[2-[[3-(4-bromophenyl)-1-methylpyrazol-5-yl]oxymethyl]phenyl]-3-methoxyprop-2-enoate.
| Compound Name | methyl (Z)-2-[2-[[3-(4-bromophenyl)-1-methylpyrazol-5-yl]oxymethyl]phenyl]-3-methoxyprop-2-enoate |
|---|---|
| PubChem CID | 102174347 |
| Molecular Formula | C22H21BrN2O4 |
| Molecular Weight | 457.32 g/mol |
| Exact Mass | 456.07 |
| IUPAC Name | methyl (Z)-2-[2-[[3-(4-bromophenyl)-1-methylpyrazol-5-yl]oxymethyl]phenyl]-3-methoxyprop-2-enoate |
| SMILES | CO/C=C(\C(=O)OC)c1ccccc1COc1cc(-c2ccc(Br)cc2)nn1C |
| InChI | InChI=1S/C22H21BrN2O4/c1-25-21(12-20(24-25)15-8-10-17(23)11-9-15)29-13-16-6-4-5-7-18(16)19(14-27-2)22(26)28-3/h4-12,14H,13H2,1-3H3/b19-14- |
| InChIKey | KLCCSPDGLWPZMC-RGEXLXHISA-N |
| XLogP | 4.59 |
| TPSA | 62.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.32 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|