C24H33ClN2O4 — CID 153326988
methyl (E)-2-[2-[(5-chloro-4-methyl-1-octylpyrazol-3-yl)oxymethyl]phenyl]-3-methoxyprop-2-enoate (PubChem CID 153326988) has the molecular formula C24H33ClN2O4 and a molecular weight of 448.99 g/mol. Its IUPAC name is methyl (E)-2-[2-[(5-chloro-4-methyl-1-octylpyrazol-3-yl)oxymethyl]phenyl]-3-methoxyprop-2-enoate.
| Compound Name | methyl (E)-2-[2-[(5-chloro-4-methyl-1-octylpyrazol-3-yl)oxymethyl]phenyl]-3-methoxyprop-2-enoate |
|---|---|
| PubChem CID | 153326988 |
| Molecular Formula | C24H33ClN2O4 |
| Molecular Weight | 448.99 g/mol |
| Exact Mass | 448.21 |
| IUPAC Name | methyl (E)-2-[2-[(5-chloro-4-methyl-1-octylpyrazol-3-yl)oxymethyl]phenyl]-3-methoxyprop-2-enoate |
| SMILES | CCCCCCCCn1nc(OCc2ccccc2/C(=C\OC)C(=O)OC)c(C)c1Cl |
| InChI | InChI=1S/C24H33ClN2O4/c1-5-6-7-8-9-12-15-27-22(25)18(2)23(26-27)31-16-19-13-10-11-14-20(19)21(17-29-3)24(28)30-4/h10-11,13-14,17H,5-9,12,15-16H2,1-4H3/b21-17+ |
| InChIKey | XXLMGFOGBNEUMU-HEHNFIMWSA-N |
| XLogP | 5.94 |
| TPSA | 62.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.99 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|