C24H30BrF3N2O4 — CID 149472338
methyl (E)-2-[2-[[5-bromo-1-(2-ethylhexyl)-4-(trifluoromethyl)pyrazol-3-yl]oxymethyl]phenyl]-3-methoxyprop-2-enoate (PubChem CID 149472338) has the molecular formula C24H30BrF3N2O4 and a molecular weight of 547.41 g/mol. Its IUPAC name is methyl (E)-2-[2-[[5-bromo-1-(2-ethylhexyl)-4-(trifluoromethyl)pyrazol-3-yl]oxymethyl]phenyl]-3-methoxyprop-2-enoate.
| Compound Name | methyl (E)-2-[2-[[5-bromo-1-(2-ethylhexyl)-4-(trifluoromethyl)pyrazol-3-yl]oxymethyl]phenyl]-3-methoxyprop-2-enoate |
|---|---|
| PubChem CID | 149472338 |
| Molecular Formula | C24H30BrF3N2O4 |
| Molecular Weight | 547.41 g/mol |
| Exact Mass | 546.13 |
| IUPAC Name | methyl (E)-2-[2-[[5-bromo-1-(2-ethylhexyl)-4-(trifluoromethyl)pyrazol-3-yl]oxymethyl]phenyl]-3-methoxyprop-2-enoate |
| SMILES | CCCCC(CC)Cn1nc(OCc2ccccc2/C(=C\OC)C(=O)OC)c(C(F)(F)F)c1Br |
| InChI | InChI=1S/C24H30BrF3N2O4/c1-5-7-10-16(6-2)13-30-21(25)20(24(26,27)28)22(29-30)34-14-17-11-8-9-12-18(17)19(15-32-3)23(31)33-4/h8-9,11-12,15-16H,5-7,10,13-14H2,1-4H3/b19-15+ |
| InChIKey | ZBPFDOCCYOBQIF-XDJHFCHBSA-N |
| XLogP | 6.62 |
| TPSA | 62.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.41 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|