C23H19F5N2O4 — CID 163805869
methyl (E)-2-[2-[[7-(1,1-difluoroethyl)-3-(trifluoromethyl)quinoxalin-2-yl]oxymethyl]phenyl]-3-methoxyprop-2-enoate (PubChem CID 163805869) has the molecular formula C23H19F5N2O4 and a molecular weight of 482.41 g/mol. Its IUPAC name is methyl (E)-2-[2-[[7-(1,1-difluoroethyl)-3-(trifluoromethyl)quinoxalin-2-yl]oxymethyl]phenyl]-3-methoxyprop-2-enoate.
| Compound Name | methyl (E)-2-[2-[[7-(1,1-difluoroethyl)-3-(trifluoromethyl)quinoxalin-2-yl]oxymethyl]phenyl]-3-methoxyprop-2-enoate |
|---|---|
| PubChem CID | 163805869 |
| Molecular Formula | C23H19F5N2O4 |
| Molecular Weight | 482.41 g/mol |
| Exact Mass | 482.13 |
| IUPAC Name | methyl (E)-2-[2-[[7-(1,1-difluoroethyl)-3-(trifluoromethyl)quinoxalin-2-yl]oxymethyl]phenyl]-3-methoxyprop-2-enoate |
| SMILES | CO/C=C(/C(=O)OC)c1ccccc1COc1nc2cc(C(C)(F)F)ccc2nc1C(F)(F)F |
| InChI | InChI=1S/C23H19F5N2O4/c1-22(24,25)14-8-9-17-18(10-14)30-20(19(29-17)23(26,27)28)34-11-13-6-4-5-7-15(13)16(12-32-2)21(31)33-3/h4-10,12H,11H2,1-3H3/b16-12+ |
| InChIKey | NIZPAEQVCFGXLH-FOWTUZBSSA-N |
| XLogP | 5.50 |
| TPSA | 70.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.41 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|