C24H20Cl2F3N3O4 — CID 71655074
methyl (E)-2-[2-[[2-(2,4-dichloroanilino)-5-methyl-6-(trifluoromethyl)pyrimidin-4-yl]oxymethyl]phenyl]-3-methoxyprop-2-enoate (PubChem CID 71655074) has the molecular formula C24H20Cl2F3N3O4 and a molecular weight of 542.34 g/mol. Its IUPAC name is methyl (E)-2-[2-[[2-(2,4-dichloroanilino)-5-methyl-6-(trifluoromethyl)pyrimidin-4-yl]oxymethyl]phenyl]-3-methoxyprop-2-enoate.
| Compound Name | methyl (E)-2-[2-[[2-(2,4-dichloroanilino)-5-methyl-6-(trifluoromethyl)pyrimidin-4-yl]oxymethyl]phenyl]-3-methoxyprop-2-enoate |
|---|---|
| PubChem CID | 71655074 |
| Molecular Formula | C24H20Cl2F3N3O4 |
| Molecular Weight | 542.34 g/mol |
| Exact Mass | 541.08 |
| IUPAC Name | methyl (E)-2-[2-[[2-(2,4-dichloroanilino)-5-methyl-6-(trifluoromethyl)pyrimidin-4-yl]oxymethyl]phenyl]-3-methoxyprop-2-enoate |
| SMILES | CO/C=C(/C(=O)OC)c1ccccc1COc1nc(Nc2ccc(Cl)cc2Cl)nc(C(F)(F)F)c1C |
| InChI | InChI=1S/C24H20Cl2F3N3O4/c1-13-20(24(27,28)29)31-23(30-19-9-8-15(25)10-18(19)26)32-21(13)36-11-14-6-4-5-7-16(14)17(12-34-2)22(33)35-3/h4-10,12H,11H2,1-3H3,(H,30,31,32)/b17-12+ |
| InChIKey | LRDCGOLOVMUEIB-SFQUDFHCSA-N |
| XLogP | 6.59 |
| TPSA | 82.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.34 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|