C18H17F3N2O6S — CID 67559351
methyl 3-methoxy-2-[2-[[2-methylsulfonyl-6-(trifluoromethyl)pyrimidin-4-yl]oxymethyl]phenyl]prop-2-enoate (PubChem CID 67559351) has the molecular formula C18H17F3N2O6S and a molecular weight of 446.40 g/mol. Its IUPAC name is methyl 3-methoxy-2-[2-[[2-methylsulfonyl-6-(trifluoromethyl)pyrimidin-4-yl]oxymethyl]phenyl]prop-2-enoate.
| Compound Name | methyl 3-methoxy-2-[2-[[2-methylsulfonyl-6-(trifluoromethyl)pyrimidin-4-yl]oxymethyl]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 67559351 |
| Molecular Formula | C18H17F3N2O6S |
| Molecular Weight | 446.40 g/mol |
| Exact Mass | 446.08 |
| IUPAC Name | methyl 3-methoxy-2-[2-[[2-methylsulfonyl-6-(trifluoromethyl)pyrimidin-4-yl]oxymethyl]phenyl]prop-2-enoate |
| SMILES | COC=C(C(=O)OC)c1ccccc1COc1cc(C(F)(F)F)nc(S(C)(=O)=O)n1 |
| InChI | InChI=1S/C18H17F3N2O6S/c1-27-10-13(16(24)28-2)12-7-5-4-6-11(12)9-29-15-8-14(18(19,20)21)22-17(23-15)30(3,25)26/h4-8,10H,9H2,1-3H3 |
| InChIKey | KZPMYYUJFYSDCM-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 104.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.40 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|