C14H19O7P — CID 54169647
methyl 2-[2-(dimethoxyphosphoryloxymethyl)phenyl]-3-methoxyprop-2-enoate (PubChem CID 54169647) has the molecular formula C14H19O7P and a molecular weight of 330.27 g/mol. Its IUPAC name is methyl 2-[2-(dimethoxyphosphoryloxymethyl)phenyl]-3-methoxyprop-2-enoate.
| Compound Name | methyl 2-[2-(dimethoxyphosphoryloxymethyl)phenyl]-3-methoxyprop-2-enoate |
|---|---|
| PubChem CID | 54169647 |
| Molecular Formula | C14H19O7P |
| Molecular Weight | 330.27 g/mol |
| Exact Mass | 330.09 |
| IUPAC Name | methyl 2-[2-(dimethoxyphosphoryloxymethyl)phenyl]-3-methoxyprop-2-enoate |
| SMILES | COC=C(C(=O)OC)c1ccccc1COP(=O)(OC)OC |
| InChI | InChI=1S/C14H19O7P/c1-17-10-13(14(15)18-2)12-8-6-5-7-11(12)9-21-22(16,19-3)20-4/h5-8,10H,9H2,1-4H3 |
| InChIKey | OUCJQEOVYYLZQQ-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.27 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|