C30H28BrO3P — CID 10886108
[2-[(E)-1,3-dimethoxy-3-oxoprop-1-en-2-yl]phenyl]methyl-triphenylphosphanium bromide (PubChem CID 10886108) has the molecular formula C30H28BrO3P and a molecular weight of 547.43 g/mol. Its IUPAC name is [2-[(E)-1,3-dimethoxy-3-oxoprop-1-en-2-yl]phenyl]methyl-triphenylphosphanium bromide.
| Compound Name | [2-[(E)-1,3-dimethoxy-3-oxoprop-1-en-2-yl]phenyl]methyl-triphenylphosphanium bromide |
|---|---|
| PubChem CID | 10886108 |
| Molecular Formula | C30H28BrO3P |
| Molecular Weight | 547.43 g/mol |
| Exact Mass | 546.10 |
| IUPAC Name | [2-[(E)-1,3-dimethoxy-3-oxoprop-1-en-2-yl]phenyl]methyl-triphenylphosphanium bromide |
| SMILES | CO/C=C(/C(=O)OC)c1ccccc1C[P+](c1ccccc1)(c1ccccc1)c1ccccc1.[Br-] |
| InChI | InChI=1S/C30H28O3P.BrH/c1-32-22-29(30(31)33-2)28-21-13-12-14-24(28)23-34(25-15-6-3-7-16-25,26-17-8-4-9-18-26)27-19-10-5-11-20-27;/h3-22H,23H2,1-2H3;1H/q+1;/p-1/b29-22+; |
| InChIKey | FPONJXHWIOEMKO-KKNNLOHISA-M |
| XLogP | 2.35 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.43 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|