About [2-[(Z)-1,3-dimethoxy-3-oxoprop-1-en-2-yl]phenyl]methyl 1-(trifluoromethyl)cyclopropane-1-carboxylate
[2-[(Z)-1,3-dimethoxy-3-oxoprop-1-en-2-yl]phenyl]methyl 1-(trifluoromethyl)cyclopropane-1-carboxylate (PubChem CID 14996300) has the molecular formula C17H17F3O5
and a molecular weight of 358.31 g/mol. Its IUPAC name is [2-[(Z)-1,3-dimethoxy-3-oxoprop-1-en-2-yl]phenyl]methyl 1-(trifluoromethyl)cyclopropane-1-carboxylate.
Molecular Properties
| Compound Name | [2-[(Z)-1,3-dimethoxy-3-oxoprop-1-en-2-yl]phenyl]methyl 1-(trifluoromethyl)cyclopropane-1-carboxylate |
| PubChem CID | 14996300 |
| Molecular Formula | C17H17F3O5 |
| Molecular Weight | 358.31 g/mol |
| Exact Mass | 358.10 |
| IUPAC Name | [2-[(Z)-1,3-dimethoxy-3-oxoprop-1-en-2-yl]phenyl]methyl 1-(trifluoromethyl)cyclopropane-1-carboxylate |
| SMILES | CO/C=C(\C(=O)OC)c1ccccc1COC(=O)C1(C(F)(F)F)CC1 |
| InChI | InChI=1S/C17H17F3O5/c1-23-10-13(14(21)24-2)12-6-4-3-5-11(12)9-25-15(22)16(7-8-16)17(18,19)20/h3-6,10H,7-9H2,1-2H3/b13-10- |
| InChIKey | QKLQDKHGLSBXTR-RAXLEYEMSA-N |
| XLogP | 3.23 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.31 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze [2-[(Z)-1,3-dimethoxy-3-oxoprop-1-en-2-yl]phenyl]methyl 1-(trifluoromethyl)cyclopropane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[(Z)-1,3-dimethoxy-3-oxoprop-1-en-2-yl]phenyl]methyl 1-(trifluoromethyl)cyclopropane-1-carboxylate?
The IUPAC name of [2-[(Z)-1,3-dimethoxy-3-oxoprop-1-en-2-yl]phenyl]methyl 1-(trifluoromethyl)cyclopropane-1-carboxylate (CID 14996300) is [2-[(Z)-1,3-dimethoxy-3-oxoprop-1-en-2-yl]phenyl]methyl 1-(trifluoromethyl)cyclopropane-1-carboxylate.
What is the SMILES notation for [2-[(Z)-1,3-dimethoxy-3-oxoprop-1-en-2-yl]phenyl]methyl 1-(trifluoromethyl)cyclopropane-1-carboxylate?
The canonical SMILES for [2-[(Z)-1,3-dimethoxy-3-oxoprop-1-en-2-yl]phenyl]methyl 1-(trifluoromethyl)cyclopropane-1-carboxylate is CO/C=C(\C(=O)OC)c1ccccc1COC(=O)C1(C(F)(F)F)CC1.
What is the InChIKey of [2-[(Z)-1,3-dimethoxy-3-oxoprop-1-en-2-yl]phenyl]methyl 1-(trifluoromethyl)cyclopropane-1-carboxylate?
The InChIKey is QKLQDKHGLSBXTR-RAXLEYEMSA-N. The full InChI is InChI=1S/C17H17F3O5/c1-23-10-13(14(21)24-2)12-6-4-3-5-11(12)9-25-15(22)16(7-8-16)17(18,19)20/h3-6,10H,7-9H2,1-2H3/b13-10-.
What are the key properties of [2-[(Z)-1,3-dimethoxy-3-oxoprop-1-en-2-yl]phenyl]methyl 1-(trifluoromethyl)cyclopropane-1-carboxylate?
[2-[(Z)-1,3-dimethoxy-3-oxoprop-1-en-2-yl]phenyl]methyl 1-(trifluoromethyl)cyclopropane-1-carboxylate has a molecular weight of 358.31 g/mol, XLogP of 3.23, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[(Z)-1,3-dimethoxy-3-oxoprop-1-en-2-yl]phenyl]methyl 1-(trifluoromethyl)cyclopropane-1-carboxylate is sourced from PubChem (CID 14996300), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).