C27H30F3NO4 — CID 59532492
methyl (E)-2-[2-[[4-[bis(cyclopropylmethyl)amino]-3-(trifluoromethyl)phenoxy]methyl]phenyl]-3-methoxyprop-2-enoate (PubChem CID 59532492) has the molecular formula C27H30F3NO4 and a molecular weight of 489.53 g/mol. Its IUPAC name is methyl (E)-2-[2-[[4-[bis(cyclopropylmethyl)amino]-3-(trifluoromethyl)phenoxy]methyl]phenyl]-3-methoxyprop-2-enoate.
| Compound Name | methyl (E)-2-[2-[[4-[bis(cyclopropylmethyl)amino]-3-(trifluoromethyl)phenoxy]methyl]phenyl]-3-methoxyprop-2-enoate |
|---|---|
| PubChem CID | 59532492 |
| Molecular Formula | C27H30F3NO4 |
| Molecular Weight | 489.53 g/mol |
| Exact Mass | 489.21 |
| IUPAC Name | methyl (E)-2-[2-[[4-[bis(cyclopropylmethyl)amino]-3-(trifluoromethyl)phenoxy]methyl]phenyl]-3-methoxyprop-2-enoate |
| SMILES | CO/C=C(/C(=O)OC)c1ccccc1COc1ccc(N(CC2CC2)CC2CC2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C27H30F3NO4/c1-33-17-23(26(32)34-2)22-6-4-3-5-20(22)16-35-21-11-12-25(24(13-21)27(28,29)30)31(14-18-7-8-18)15-19-9-10-19/h3-6,11-13,17-19H,7-10,14-16H2,1-2H3/b23-17+ |
| InChIKey | CJRPZPCIVXNWNY-HAVVHWLPSA-N |
| XLogP | 6.07 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.53 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|