C19H18F3NO3S — CID 54264337
methyl 2-[2-[[2-amino-4-(trifluoromethyl)phenyl]sulfanylmethyl]phenyl]-3-methoxyprop-2-enoate (PubChem CID 54264337) has the molecular formula C19H18F3NO3S and a molecular weight of 397.42 g/mol. Its IUPAC name is methyl 2-[2-[[2-amino-4-(trifluoromethyl)phenyl]sulfanylmethyl]phenyl]-3-methoxyprop-2-enoate.
| Compound Name | methyl 2-[2-[[2-amino-4-(trifluoromethyl)phenyl]sulfanylmethyl]phenyl]-3-methoxyprop-2-enoate |
|---|---|
| PubChem CID | 54264337 |
| Molecular Formula | C19H18F3NO3S |
| Molecular Weight | 397.42 g/mol |
| Exact Mass | 397.10 |
| IUPAC Name | methyl 2-[2-[[2-amino-4-(trifluoromethyl)phenyl]sulfanylmethyl]phenyl]-3-methoxyprop-2-enoate |
| SMILES | COC=C(C(=O)OC)c1ccccc1CSc1ccc(C(F)(F)F)cc1N |
| InChI | InChI=1S/C19H18F3NO3S/c1-25-10-15(18(24)26-2)14-6-4-3-5-12(14)11-27-17-8-7-13(9-16(17)23)19(20,21)22/h3-10H,11,23H2,1-2H3 |
| InChIKey | RFRZCNIEDLKUQX-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.42 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|