C15H15F3N2S — CID 10828902
2-[2-(methylaminomethyl)phenyl]sulfanyl-5-(trifluoromethyl)aniline (PubChem CID 10828902) has the molecular formula C15H15F3N2S and a molecular weight of 312.36 g/mol. Its IUPAC name is 2-[2-(methylaminomethyl)phenyl]sulfanyl-5-(trifluoromethyl)aniline.
| Compound Name | 2-[2-(methylaminomethyl)phenyl]sulfanyl-5-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 10828902 |
| Molecular Formula | C15H15F3N2S |
| Molecular Weight | 312.36 g/mol |
| Exact Mass | 312.09 |
| IUPAC Name | 2-[2-(methylaminomethyl)phenyl]sulfanyl-5-(trifluoromethyl)aniline |
| SMILES | CNCc1ccccc1Sc1ccc(C(F)(F)F)cc1N |
| InChI | InChI=1S/C15H15F3N2S/c1-20-9-10-4-2-3-5-13(10)21-14-7-6-11(8-12(14)19)15(16,17)18/h2-8,20H,9,19H2,1H3 |
| InChIKey | YDFKXFSQCRCVDD-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.36 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|