C11H11F3N2O3S — CID 43251143
methyl N-[2-[2-amino-4-(trifluoromethyl)phenyl]sulfanylacetyl]carbamate (PubChem CID 43251143) has the molecular formula C11H11F3N2O3S and a molecular weight of 308.28 g/mol. Its IUPAC name is methyl N-[2-[2-amino-4-(trifluoromethyl)phenyl]sulfanylacetyl]carbamate.
| Compound Name | methyl N-[2-[2-amino-4-(trifluoromethyl)phenyl]sulfanylacetyl]carbamate |
|---|---|
| PubChem CID | 43251143 |
| Molecular Formula | C11H11F3N2O3S |
| Molecular Weight | 308.28 g/mol |
| Exact Mass | 308.04 |
| IUPAC Name | methyl N-[2-[2-amino-4-(trifluoromethyl)phenyl]sulfanylacetyl]carbamate |
| SMILES | COC(=O)NC(=O)CSc1ccc(C(F)(F)F)cc1N |
| InChI | InChI=1S/C11H11F3N2O3S/c1-19-10(18)16-9(17)5-20-8-3-2-6(4-7(8)15)11(12,13)14/h2-4H,5,15H2,1H3,(H,16,17,18) |
| InChIKey | ONOMVFIZWFVRHG-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.28 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|