C14H19F3N2OS — CID 43251162
2-[2-amino-4-(trifluoromethyl)phenyl]sulfanyl-N-(3-methylbutan-2-yl)acetamide (PubChem CID 43251162) has the molecular formula C14H19F3N2OS and a molecular weight of 320.38 g/mol. Its IUPAC name is 2-[2-amino-4-(trifluoromethyl)phenyl]sulfanyl-N-(3-methylbutan-2-yl)acetamide.
| Compound Name | 2-[2-amino-4-(trifluoromethyl)phenyl]sulfanyl-N-(3-methylbutan-2-yl)acetamide |
|---|---|
| PubChem CID | 43251162 |
| Molecular Formula | C14H19F3N2OS |
| Molecular Weight | 320.38 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | 2-[2-amino-4-(trifluoromethyl)phenyl]sulfanyl-N-(3-methylbutan-2-yl)acetamide |
| SMILES | CC(C)C(C)NC(=O)CSc1ccc(C(F)(F)F)cc1N |
| InChI | InChI=1S/C14H19F3N2OS/c1-8(2)9(3)19-13(20)7-21-12-5-4-10(6-11(12)18)14(15,16)17/h4-6,8-9H,7,18H2,1-3H3,(H,19,20) |
| InChIKey | JFQRLZNIKIWVIL-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.38 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|