C10H10F3N3O2S — CID 43247407
2-[2-amino-4-(trifluoromethyl)phenyl]sulfanyl-N-carbamoylacetamide (PubChem CID 43247407) has the molecular formula C10H10F3N3O2S and a molecular weight of 293.27 g/mol. Its IUPAC name is 2-[2-amino-4-(trifluoromethyl)phenyl]sulfanyl-N-carbamoylacetamide.
| Compound Name | 2-[2-amino-4-(trifluoromethyl)phenyl]sulfanyl-N-carbamoylacetamide |
|---|---|
| PubChem CID | 43247407 |
| Molecular Formula | C10H10F3N3O2S |
| Molecular Weight | 293.27 g/mol |
| Exact Mass | 293.04 |
| IUPAC Name | 2-[2-amino-4-(trifluoromethyl)phenyl]sulfanyl-N-carbamoylacetamide |
| SMILES | NC(=O)NC(=O)CSc1ccc(C(F)(F)F)cc1N |
| InChI | InChI=1S/C10H10F3N3O2S/c11-10(12,13)5-1-2-7(6(14)3-5)19-4-8(17)16-9(15)18/h1-3H,4,14H2,(H3,15,16,17,18) |
| InChIKey | YHNAVLXFOHGGJY-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.27 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|