C13H17F3N2OS — CID 43247403
2-[2-amino-4-(trifluoromethyl)phenyl]sulfanyl-N,N-diethylacetamide (PubChem CID 43247403) has the molecular formula C13H17F3N2OS and a molecular weight of 306.35 g/mol. Its IUPAC name is 2-[2-amino-4-(trifluoromethyl)phenyl]sulfanyl-N,N-diethylacetamide.
| Compound Name | 2-[2-amino-4-(trifluoromethyl)phenyl]sulfanyl-N,N-diethylacetamide |
|---|---|
| PubChem CID | 43247403 |
| Molecular Formula | C13H17F3N2OS |
| Molecular Weight | 306.35 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | 2-[2-amino-4-(trifluoromethyl)phenyl]sulfanyl-N,N-diethylacetamide |
| SMILES | CCN(CC)C(=O)CSc1ccc(C(F)(F)F)cc1N |
| InChI | InChI=1S/C13H17F3N2OS/c1-3-18(4-2)12(19)8-20-11-6-5-9(7-10(11)17)13(14,15)16/h5-7H,3-4,8,17H2,1-2H3 |
| InChIKey | IZNHWBCCBOGOQI-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.35 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|