C12H16F2N2OS — CID 112751943
2-(2-amino-4,5-difluorophenyl)sulfanyl-N,N-diethylacetamide (PubChem CID 112751943) has the molecular formula C12H16F2N2OS and a molecular weight of 274.34 g/mol. Its IUPAC name is 2-(2-amino-4,5-difluorophenyl)sulfanyl-N,N-diethylacetamide.
| Compound Name | 2-(2-amino-4,5-difluorophenyl)sulfanyl-N,N-diethylacetamide |
|---|---|
| PubChem CID | 112751943 |
| Molecular Formula | C12H16F2N2OS |
| Molecular Weight | 274.34 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | 2-(2-amino-4,5-difluorophenyl)sulfanyl-N,N-diethylacetamide |
| SMILES | CCN(CC)C(=O)CSc1cc(F)c(F)cc1N |
| InChI | InChI=1S/C12H16F2N2OS/c1-3-16(4-2)12(17)7-18-11-6-9(14)8(13)5-10(11)15/h5-6H,3-4,7,15H2,1-2H3 |
| InChIKey | UVNSNFTYZLDROC-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.34 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|