C8H9F2NS — CID 130536650
2-ethylsulfanyl-4,5-difluoroaniline (PubChem CID 130536650) has the molecular formula C8H9F2NS and a molecular weight of 189.23 g/mol. Its IUPAC name is 2-ethylsulfanyl-4,5-difluoroaniline.
| Compound Name | 2-ethylsulfanyl-4,5-difluoroaniline |
|---|---|
| PubChem CID | 130536650 |
| Molecular Formula | C8H9F2NS |
| Molecular Weight | 189.23 g/mol |
| Exact Mass | 189.04 |
| IUPAC Name | 2-ethylsulfanyl-4,5-difluoroaniline |
| SMILES | CCSc1cc(F)c(F)cc1N |
| InChI | InChI=1S/C8H9F2NS/c1-2-12-8-4-6(10)5(9)3-7(8)11/h3-4H,2,11H2,1H3 |
| InChIKey | PREAGCRKHZMTBA-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.23 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|