C10H15NO2S — CID 12694267
2-ethylsulfanyl-4,5-dimethoxyaniline (PubChem CID 12694267) has the molecular formula C10H15NO2S and a molecular weight of 213.30 g/mol. Its IUPAC name is 2-ethylsulfanyl-4,5-dimethoxyaniline.
| Compound Name | 2-ethylsulfanyl-4,5-dimethoxyaniline |
|---|---|
| PubChem CID | 12694267 |
| Molecular Formula | C10H15NO2S |
| Molecular Weight | 213.30 g/mol |
| Exact Mass | 213.08 |
| IUPAC Name | 2-ethylsulfanyl-4,5-dimethoxyaniline |
| SMILES | CCSc1cc(OC)c(OC)cc1N |
| InChI | InChI=1S/C10H15NO2S/c1-4-14-10-6-9(13-3)8(12-2)5-7(10)11/h5-6H,4,11H2,1-3H3 |
| InChIKey | TZSYHJBPGOIJDO-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.30 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|