C12H20N2O2 — CID 82552842
2-(1-aminobutyl)-4,5-dimethoxyaniline (PubChem CID 82552842) has the molecular formula C12H20N2O2 and a molecular weight of 224.30 g/mol. Its IUPAC name is 2-(1-aminobutyl)-4,5-dimethoxyaniline.
| Compound Name | 2-(1-aminobutyl)-4,5-dimethoxyaniline |
|---|---|
| PubChem CID | 82552842 |
| Molecular Formula | C12H20N2O2 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.15 |
| IUPAC Name | 2-(1-aminobutyl)-4,5-dimethoxyaniline |
| SMILES | CCCC(N)c1cc(OC)c(OC)cc1N |
| InChI | InChI=1S/C12H20N2O2/c1-4-5-9(13)8-6-11(15-2)12(16-3)7-10(8)14/h6-7,9H,4-5,13-14H2,1-3H3 |
| InChIKey | AKQZDTWTBAAWLV-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|