C12H20ClNO2 — CID 86262898
1-(2,5-dimethoxyphenyl)butan-1-amine;hydrochloride (PubChem CID 86262898) has the molecular formula C12H20ClNO2 and a molecular weight of 245.75 g/mol. Its IUPAC name is 1-(2,5-dimethoxyphenyl)butan-1-amine;hydrochloride.
| Compound Name | 1-(2,5-dimethoxyphenyl)butan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 86262898 |
| Molecular Formula | C12H20ClNO2 |
| Molecular Weight | 245.75 g/mol |
| Exact Mass | 245.12 |
| IUPAC Name | 1-(2,5-dimethoxyphenyl)butan-1-amine;hydrochloride |
| SMILES | CCCC(N)c1cc(OC)ccc1OC.Cl |
| InChI | InChI=1S/C12H19NO2.ClH/c1-4-5-11(13)10-8-9(14-2)6-7-12(10)15-3;/h6-8,11H,4-5,13H2,1-3H3;1H |
| InChIKey | ZQBJABSSBYSAJJ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.75 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |