C12H17IN2OS — CID 114233313
2-(2-amino-4-iodophenyl)sulfanyl-N,N-diethylacetamide (PubChem CID 114233313) has the molecular formula C12H17IN2OS and a molecular weight of 364.25 g/mol. Its IUPAC name is 2-(2-amino-4-iodophenyl)sulfanyl-N,N-diethylacetamide.
| Compound Name | 2-(2-amino-4-iodophenyl)sulfanyl-N,N-diethylacetamide |
|---|---|
| PubChem CID | 114233313 |
| Molecular Formula | C12H17IN2OS |
| Molecular Weight | 364.25 g/mol |
| Exact Mass | 364.01 |
| IUPAC Name | 2-(2-amino-4-iodophenyl)sulfanyl-N,N-diethylacetamide |
| SMILES | CCN(CC)C(=O)CSc1ccc(I)cc1N |
| InChI | InChI=1S/C12H17IN2OS/c1-3-15(4-2)12(16)8-17-11-6-5-9(13)7-10(11)14/h5-7H,3-4,8,14H2,1-2H3 |
| InChIKey | AZFPIMPBKDFMCM-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.25 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|