C14H21NO2S — CID 64665943
N,N-diethyl-2-[3-(1-hydroxyethyl)phenyl]sulfanylacetamide (PubChem CID 64665943) has the molecular formula C14H21NO2S and a molecular weight of 267.39 g/mol. Its IUPAC name is N,N-diethyl-2-[3-(1-hydroxyethyl)phenyl]sulfanylacetamide.
| Compound Name | N,N-diethyl-2-[3-(1-hydroxyethyl)phenyl]sulfanylacetamide |
|---|---|
| PubChem CID | 64665943 |
| Molecular Formula | C14H21NO2S |
| Molecular Weight | 267.39 g/mol |
| Exact Mass | 267.13 |
| IUPAC Name | N,N-diethyl-2-[3-(1-hydroxyethyl)phenyl]sulfanylacetamide |
| SMILES | CCN(CC)C(=O)CSc1cccc(C(C)O)c1 |
| InChI | InChI=1S/C14H21NO2S/c1-4-15(5-2)14(17)10-18-13-8-6-7-12(9-13)11(3)16/h6-9,11,16H,4-5,10H2,1-3H3 |
| InChIKey | FZSSQVMIDKMJLH-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.39 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |