C13H18OS — CID 66038314
1-[3-(2-methylidenebutylsulfanyl)phenyl]ethanol (PubChem CID 66038314) has the molecular formula C13H18OS and a molecular weight of 222.35 g/mol. Its IUPAC name is 1-[3-(2-methylidenebutylsulfanyl)phenyl]ethanol.
| Compound Name | 1-[3-(2-methylidenebutylsulfanyl)phenyl]ethanol |
|---|---|
| PubChem CID | 66038314 |
| Molecular Formula | C13H18OS |
| Molecular Weight | 222.35 g/mol |
| Exact Mass | 222.11 |
| IUPAC Name | 1-[3-(2-methylidenebutylsulfanyl)phenyl]ethanol |
| SMILES | C=C(CC)CSc1cccc(C(C)O)c1 |
| InChI | InChI=1S/C13H18OS/c1-4-10(2)9-15-13-7-5-6-12(8-13)11(3)14/h5-8,11,14H,2,4,9H2,1,3H3 |
| InChIKey | IHCNBQOJNKIWRT-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.35 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|