C13H18N2O4S2 — CID 21209852
N,N-diethyl-2-(4-methylsulfinyl-2-nitrophenyl)sulfanylacetamide (PubChem CID 21209852) has the molecular formula C13H18N2O4S2 and a molecular weight of 330.43 g/mol. Its IUPAC name is N,N-diethyl-2-(4-methylsulfinyl-2-nitrophenyl)sulfanylacetamide.
| Compound Name | N,N-diethyl-2-(4-methylsulfinyl-2-nitrophenyl)sulfanylacetamide |
|---|---|
| PubChem CID | 21209852 |
| Molecular Formula | C13H18N2O4S2 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.07 |
| IUPAC Name | N,N-diethyl-2-(4-methylsulfinyl-2-nitrophenyl)sulfanylacetamide |
| SMILES | CCN(CC)C(=O)CSc1ccc(S(C)=O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H18N2O4S2/c1-4-14(5-2)13(16)9-20-12-7-6-10(21(3)19)8-11(12)15(17)18/h6-8H,4-5,9H2,1-3H3 |
| InChIKey | PKAKOLYXWUBYGP-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 80.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|