C15H21N3O6S — CID 29203852
4-[2-[bis(2-methoxyethyl)amino]-2-oxoethyl]sulfanyl-3-nitrobenzamide (PubChem CID 29203852) has the molecular formula C15H21N3O6S and a molecular weight of 371.42 g/mol. Its IUPAC name is 4-[2-[bis(2-methoxyethyl)amino]-2-oxoethyl]sulfanyl-3-nitrobenzamide.
| Compound Name | 4-[2-[bis(2-methoxyethyl)amino]-2-oxoethyl]sulfanyl-3-nitrobenzamide |
|---|---|
| PubChem CID | 29203852 |
| Molecular Formula | C15H21N3O6S |
| Molecular Weight | 371.42 g/mol |
| Exact Mass | 371.12 |
| IUPAC Name | 4-[2-[bis(2-methoxyethyl)amino]-2-oxoethyl]sulfanyl-3-nitrobenzamide |
| SMILES | COCCN(CCOC)C(=O)CSc1ccc(C(N)=O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H21N3O6S/c1-23-7-5-17(6-8-24-2)14(19)10-25-13-4-3-11(15(16)20)9-12(13)18(21)22/h3-4,9H,5-8,10H2,1-2H3,(H2,16,20) |
| InChIKey | OMALOENOCRLEPZ-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 125.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.42 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|