C15H22N4O4S — CID 119605659
4-[2-[(1-amino-2,3-dimethylbutan-2-yl)amino]-2-oxoethyl]sulfanyl-3-nitrobenzamide (PubChem CID 119605659) has the molecular formula C15H22N4O4S and a molecular weight of 354.43 g/mol. Its IUPAC name is 4-[2-[(1-amino-2,3-dimethylbutan-2-yl)amino]-2-oxoethyl]sulfanyl-3-nitrobenzamide.
| Compound Name | 4-[2-[(1-amino-2,3-dimethylbutan-2-yl)amino]-2-oxoethyl]sulfanyl-3-nitrobenzamide |
|---|---|
| PubChem CID | 119605659 |
| Molecular Formula | C15H22N4O4S |
| Molecular Weight | 354.43 g/mol |
| Exact Mass | 354.14 |
| IUPAC Name | 4-[2-[(1-amino-2,3-dimethylbutan-2-yl)amino]-2-oxoethyl]sulfanyl-3-nitrobenzamide |
| SMILES | CC(C)C(C)(CN)NC(=O)CSc1ccc(C(N)=O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H22N4O4S/c1-9(2)15(3,8-16)18-13(20)7-24-12-5-4-10(14(17)21)6-11(12)19(22)23/h4-6,9H,7-8,16H2,1-3H3,(H2,17,21)(H,18,20) |
| InChIKey | BNCLVLRBIVAWIJ-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 141.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.43 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|